C15H21FN2O3 — CID 120795026
(2S,5R)-5-(aminomethyl)-N-[2-(3-fluorophenoxy)propyl]oxolane-2-carboxamide (PubChem CID 120795026) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[2-(3-fluorophenoxy)propyl]oxolane-2-carboxamide.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[2-(3-fluorophenoxy)propyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 120795026 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[2-(3-fluorophenoxy)propyl]oxolane-2-carboxamide |
| SMILES | CC(CNC(=O)[C@@H]1CC[C@H](CN)O1)Oc1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c1-10(20-12-4-2-3-11(16)7-12)9-18-15(19)14-6-5-13(8-17)21-14/h2-4,7,10,13-14H,5-6,8-9,17H2,1H3,(H,18,19)/t10?,13-,14+/m1/s1 |
| InChIKey | MOTZMKREZAGOPP-ADSMYIAOSA-N |
| XLogP | 1.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |