C15H29ClN2O3 — CID 120796417
(2S,5R)-5-(aminomethyl)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]oxolane-2-carboxamide;hydrochloride (PubChem CID 120796417) has the molecular formula C15H29ClN2O3 and a molecular weight of 320.86 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]oxolane-2-carboxamide;hydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]oxolane-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120796417 |
| Molecular Formula | C15H29ClN2O3 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[[1-(2-ethoxyethyl)cyclobutyl]methyl]oxolane-2-carboxamide;hydrochloride |
| SMILES | CCOCCC1(CNC(=O)[C@@H]2CC[C@H](CN)O2)CCC1.Cl |
| InChI | InChI=1S/C15H28N2O3.ClH/c1-2-19-9-8-15(6-3-7-15)11-17-14(18)13-5-4-12(10-16)20-13;/h12-13H,2-11,16H2,1H3,(H,17,18);1H/t12-,13+;/m1./s1 |
| InChIKey | DEIGYUOBSSMGCF-KZCZEQIWSA-N |
| XLogP | 1.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|