C15H29ClN2O3 — CID 120796599
2-amino-1-[3-(2-methylpropoxy)pyrrolidin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride (PubChem CID 120796599) has the molecular formula C15H29ClN2O3 and a molecular weight of 320.86 g/mol. Its IUPAC name is 2-amino-1-[3-(2-methylpropoxy)pyrrolidin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-[3-(2-methylpropoxy)pyrrolidin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120796599 |
| Molecular Formula | C15H29ClN2O3 |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | 2-amino-1-[3-(2-methylpropoxy)pyrrolidin-1-yl]-2-(oxan-4-yl)ethanone;hydrochloride |
| SMILES | CC(C)COC1CCN(C(=O)C(N)C2CCOCC2)C1.Cl |
| InChI | InChI=1S/C15H28N2O3.ClH/c1-11(2)10-20-13-3-6-17(9-13)15(18)14(16)12-4-7-19-8-5-12;/h11-14H,3-10,16H2,1-2H3;1H |
| InChIKey | DEDLRBOJDABSOJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |