C16H24Cl2N4O2 — CID 120797737
2-amino-N-[2-(benzimidazol-1-yl)ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride (PubChem CID 120797737) has the molecular formula C16H24Cl2N4O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-amino-N-[2-(benzimidazol-1-yl)ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[2-(benzimidazol-1-yl)ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 120797737 |
| Molecular Formula | C16H24Cl2N4O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-amino-N-[2-(benzimidazol-1-yl)ethyl]-2-(oxan-4-yl)acetamide;dihydrochloride |
| SMILES | Cl.Cl.NC(C(=O)NCCn1cnc2ccccc21)C1CCOCC1 |
| InChI | InChI=1S/C16H22N4O2.2ClH/c17-15(12-5-9-22-10-6-12)16(21)18-7-8-20-11-19-13-3-1-2-4-14(13)20;;/h1-4,11-12,15H,5-10,17H2,(H,18,21);2*1H |
| InChIKey | HNDPSQIHQBIDTI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |