C19H28ClN3O3 — CID 120799806
2-amino-N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-(oxan-4-yl)acetamide (PubChem CID 120799806) has the molecular formula C19H28ClN3O3 and a molecular weight of 381.90 g/mol. Its IUPAC name is 2-amino-N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120799806 |
| Molecular Formula | C19H28ClN3O3 |
| Molecular Weight | 381.90 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | 2-amino-N-[2-(3-chlorophenyl)-2-morpholin-4-ylethyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)NCC(c1cccc(Cl)c1)N1CCOCC1)C1CCOCC1 |
| InChI | InChI=1S/C19H28ClN3O3/c20-16-3-1-2-15(12-16)17(23-6-10-26-11-7-23)13-22-19(24)18(21)14-4-8-25-9-5-14/h1-3,12,14,17-18H,4-11,13,21H2,(H,22,24) |
| InChIKey | NHGBMZNFORBPLL-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.90 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |