C18H26FN3O3 — CID 120801004
2-amino-N-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-(oxan-4-yl)acetamide (PubChem CID 120801004) has the molecular formula C18H26FN3O3 and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-amino-N-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120801004 |
| Molecular Formula | C18H26FN3O3 |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-amino-N-[(5-fluoro-2-morpholin-4-ylphenyl)methyl]-2-(oxan-4-yl)acetamide |
| SMILES | NC(C(=O)NCc1cc(F)ccc1N1CCOCC1)C1CCOCC1 |
| InChI | InChI=1S/C18H26FN3O3/c19-15-1-2-16(22-5-9-25-10-6-22)14(11-15)12-21-18(23)17(20)13-3-7-24-8-4-13/h1-2,11,13,17H,3-10,12,20H2,(H,21,23) |
| InChIKey | SHQRSXOCHVKRRL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |