C14H15N7 — CID 1208027
6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)-1,2,4,5-tetrazin-3-amine (PubChem CID 1208027) has the molecular formula C14H15N7 and a molecular weight of 281.32 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)-1,2,4,5-tetrazin-3-amine.
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)-1,2,4,5-tetrazin-3-amine |
|---|---|
| PubChem CID | 1208027 |
| Molecular Formula | C14H15N7 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-N-(4-methylphenyl)-1,2,4,5-tetrazin-3-amine |
| SMILES | Cc1ccc(Nc2nnc(-n3nc(C)cc3C)nn2)cc1 |
| InChI | InChI=1S/C14H15N7/c1-9-4-6-12(7-5-9)15-13-16-18-14(19-17-13)21-11(3)8-10(2)20-21/h4-8H,1-3H3,(H,15,16,17) |
| InChIKey | JPWKUXSIWNAQBY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|