C18H18ClFN2O — CID 120803593
1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-fluorophenyl)ethanone (PubChem CID 120803593) has the molecular formula C18H18ClFN2O and a molecular weight of 332.81 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-fluorophenyl)ethanone.
| Compound Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 120803593 |
| Molecular Formula | C18H18ClFN2O |
| Molecular Weight | 332.81 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-[2-(3-chlorophenyl)piperazin-1-yl]-2-(4-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCNCC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2O/c19-15-3-1-2-14(11-15)17-12-21-8-9-22(17)18(23)10-13-4-6-16(20)7-5-13/h1-7,11,17,21H,8-10,12H2 |
| InChIKey | OCGOOTWBASJIOV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.81 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |