C31H34F3N3O4 — CID 1208037
6,8-difluoro-1-[3-fluoro-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenyl]-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (PubChem CID 1208037) has the molecular formula C31H34F3N3O4 and a molecular weight of 569.62 g/mol. Its IUPAC name is 6,8-difluoro-1-[3-fluoro-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenyl]-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 6,8-difluoro-1-[3-fluoro-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenyl]-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 1208037 |
| Molecular Formula | C31H34F3N3O4 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 6,8-difluoro-1-[3-fluoro-4-[[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]oxy]phenyl]-7-(4-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| SMILES | CN1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn(-c4ccc(O[C@@H]5C[C@@H]6CC[C@@]5(C)C6(C)C)c(F)c4)c3c2F)CC1 |
| InChI | InChI=1S/C31H34F3N3O4/c1-30(2)17-7-8-31(30,3)24(13-17)41-23-6-5-18(14-21(23)32)37-16-20(29(39)40)28(38)19-15-22(33)27(25(34)26(19)37)36-11-9-35(4)10-12-36/h5-6,14-17,24H,7-13H2,1-4H3,(H,39,40)/t17-,24+,31+/m0/s1 |
| InChIKey | OXYVIWLLSXQJPD-VWWUHSKFSA-N |
| XLogP | 5.45 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |