C20H24ClN3O2 — CID 120804908
N-[4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]benzamide;hydrochloride (PubChem CID 120804908) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]benzamide;hydrochloride.
| Compound Name | N-[4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 120804908 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[4-[3-(aminomethyl)-3-methylpyrrolidine-1-carbonyl]phenyl]benzamide;hydrochloride |
| SMILES | CC1(CN)CCN(C(=O)c2ccc(NC(=O)c3ccccc3)cc2)C1.Cl |
| InChI | InChI=1S/C20H23N3O2.ClH/c1-20(13-21)11-12-23(14-20)19(25)16-7-9-17(10-8-16)22-18(24)15-5-3-2-4-6-15;/h2-10H,11-14,21H2,1H3,(H,22,24);1H |
| InChIKey | CAEVNEGMUOAYEC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |