C15H26N6O3 — CID 120806279
1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]butan-1-one (PubChem CID 120806279) has the molecular formula C15H26N6O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]butan-1-one.
| Compound Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]butan-1-one |
|---|---|
| PubChem CID | 120806279 |
| Molecular Formula | C15H26N6O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-2-[(1,3-dimethyl-4-nitropyrazol-5-yl)amino]butan-1-one |
| SMILES | CCC(Nc1c([N+](=O)[O-])c(C)nn1C)C(=O)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C15H26N6O3/c1-5-11(14(22)20-7-6-15(3,8-16)9-20)17-13-12(21(23)24)10(2)18-19(13)4/h11,17H,5-9,16H2,1-4H3 |
| InChIKey | NEBAHGVZHRETII-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|