C13H17ClFIN2O — CID 120806444
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-iodophenyl)methanone;hydrochloride (PubChem CID 120806444) has the molecular formula C13H17ClFIN2O and a molecular weight of 398.65 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-iodophenyl)methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-iodophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120806444 |
| Molecular Formula | C13H17ClFIN2O |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-fluoro-2-iodophenyl)methanone;hydrochloride |
| SMILES | CC1(CN)CCN(C(=O)c2cc(F)ccc2I)C1.Cl |
| InChI | InChI=1S/C13H16FIN2O.ClH/c1-13(7-16)4-5-17(8-13)12(18)10-6-9(14)2-3-11(10)15;/h2-3,6H,4-5,7-8,16H2,1H3;1H |
| InChIKey | SYBWDWRPINFZBB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|