C19H24N4O — CID 120806575
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-cyclopropyl-1-phenylpyrazol-4-yl)methanone (PubChem CID 120806575) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-cyclopropyl-1-phenylpyrazol-4-yl)methanone.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-cyclopropyl-1-phenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 120806575 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-cyclopropyl-1-phenylpyrazol-4-yl)methanone |
| SMILES | CC1(CN)CCN(C(=O)c2cnn(-c3ccccc3)c2C2CC2)C1 |
| InChI | InChI=1S/C19H24N4O/c1-19(12-20)9-10-22(13-19)18(24)16-11-21-23(17(16)14-7-8-14)15-5-3-2-4-6-15/h2-6,11,14H,7-10,12-13,20H2,1H3 |
| InChIKey | RFDAGZOAEFGCHC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |