C13H15F6N3O — CID 1208092
N-[2-[(4,6-dimethyl-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide (PubChem CID 1208092) has the molecular formula C13H15F6N3O and a molecular weight of 343.27 g/mol. Its IUPAC name is N-[2-[(4,6-dimethyl-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide.
| Compound Name | N-[2-[(4,6-dimethyl-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide |
|---|---|
| PubChem CID | 1208092 |
| Molecular Formula | C13H15F6N3O |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | N-[2-[(4,6-dimethyl-2-pyridinyl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]propanamide |
| SMILES | CCC(=O)NC(Nc1cc(C)cc(C)n1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H15F6N3O/c1-4-10(23)22-11(12(14,15)16,13(17,18)19)21-9-6-7(2)5-8(3)20-9/h5-6H,4H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | ZPRFXZHLKQVOAC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|