C17H25ClN4O3 — CID 120809562
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone;hydrochloride (PubChem CID 120809562) has the molecular formula C17H25ClN4O3 and a molecular weight of 368.87 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone;hydrochloride.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120809562 |
| Molecular Formula | C17H25ClN4O3 |
| Molecular Weight | 368.87 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(3-nitro-4-pyrrolidin-1-ylphenyl)methanone;hydrochloride |
| SMILES | CC1(CN)CCN(C(=O)c2ccc(N3CCCC3)c([N+](=O)[O-])c2)C1.Cl |
| InChI | InChI=1S/C17H24N4O3.ClH/c1-17(11-18)6-9-20(12-17)16(22)13-4-5-14(15(10-13)21(23)24)19-7-2-3-8-19;/h4-5,10H,2-3,6-9,11-12,18H2,1H3;1H |
| InChIKey | ZBNUXUHRHVEXIL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.87 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|