C9H9F6N3OS — CID 1208098
N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]acetamide (PubChem CID 1208098) has the molecular formula C9H9F6N3OS and a molecular weight of 321.25 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]acetamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 1208098 |
| Molecular Formula | C9H9F6N3OS |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(Nc1ncc(C)s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H9F6N3OS/c1-4-3-16-6(20-4)18-7(8(10,11)12,9(13,14)15)17-5(2)19/h3H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | WAYUQAMHURAOCK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|