C12H17BrN2O2 — CID 120810041
[3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-bromo-3-methylfuran-2-yl)methanone (PubChem CID 120810041) has the molecular formula C12H17BrN2O2 and a molecular weight of 301.18 g/mol. Its IUPAC name is [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-bromo-3-methylfuran-2-yl)methanone.
| Compound Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-bromo-3-methylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 120810041 |
| Molecular Formula | C12H17BrN2O2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | [3-(aminomethyl)-3-methylpyrrolidin-1-yl]-(5-bromo-3-methylfuran-2-yl)methanone |
| SMILES | Cc1cc(Br)oc1C(=O)N1CCC(C)(CN)C1 |
| InChI | InChI=1S/C12H17BrN2O2/c1-8-5-9(13)17-10(8)11(16)15-4-3-12(2,6-14)7-15/h5H,3-4,6-7,14H2,1-2H3 |
| InChIKey | MQJCMOHJHRVJHZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |