C10H11F6N3OS — CID 1208101
N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]propanamide (PubChem CID 1208101) has the molecular formula C10H11F6N3OS and a molecular weight of 335.27 g/mol. Its IUPAC name is N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]propanamide.
| Compound Name | N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]propanamide |
|---|---|
| PubChem CID | 1208101 |
| Molecular Formula | C10H11F6N3OS |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[1,1,1,3,3,3-hexafluoro-2-[(5-methyl-1,3-thiazol-2-yl)amino]propan-2-yl]propanamide |
| SMILES | CCC(=O)NC(Nc1ncc(C)s1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H11F6N3OS/c1-3-6(20)18-8(9(11,12)13,10(14,15)16)19-7-17-4-5(2)21-7/h4H,3H2,1-2H3,(H,17,19)(H,18,20) |
| InChIKey | AARUWUIOTZXIGJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|