C13H25F3N4O4S — CID 120811413
2-(2-ethoxyethylsulfonylamino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide (PubChem CID 120811413) has the molecular formula C13H25F3N4O4S and a molecular weight of 390.43 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfonylamino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(2-ethoxyethylsulfonylamino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 120811413 |
| Molecular Formula | C13H25F3N4O4S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-(2-ethoxyethylsulfonylamino)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
| SMILES | CCOCCS(=O)(=O)NCC(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C13H25F3N4O4S/c1-2-24-7-8-25(22,23)19-10-12(21)18-9-11(13(14,15)16)20-5-3-17-4-6-20/h11,17,19H,2-10H2,1H3,(H,18,21) |
| InChIKey | UKBAGKGWZACYNH-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|