About N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide
N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide (PubChem CID 120811589) has the molecular formula C10H14F3N5OS
and a molecular weight of 309.32 g/mol. Its IUPAC name is N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide |
| PubChem CID | 120811589 |
| Molecular Formula | C10H14F3N5OS |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide |
| SMILES | O=C(NCC(N1CCNCC1)C(F)(F)F)c1cnns1 |
| InChI | InChI=1S/C10H14F3N5OS/c11-10(12,13)8(18-3-1-14-2-4-18)6-15-9(19)7-5-16-17-20-7/h5,8,14H,1-4,6H2,(H,15,19) |
| InChIKey | SVQVYSTYJRLUJT-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
The IUPAC name of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide (CID 120811589) is N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide.
What is the SMILES notation for N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
The canonical SMILES for N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide is O=C(NCC(N1CCNCC1)C(F)(F)F)c1cnns1.
What is the InChIKey of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
The InChIKey is SVQVYSTYJRLUJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F3N5OS/c11-10(12,13)8(18-3-1-14-2-4-18)6-15-9(19)7-5-16-17-20-7/h5,8,14H,1-4,6H2,(H,15,19).
What are the key properties of N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide has a molecular weight of 309.32 g/mol, XLogP of 0.10, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide is sourced from PubChem (CID 120811589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).