C12H19F3N4O2S — CID 120812587
2-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide (PubChem CID 120812587) has the molecular formula C12H19F3N4O2S and a molecular weight of 340.37 g/mol. Its IUPAC name is 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 120812587 |
| Molecular Formula | C12H19F3N4O2S |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(2-oxo-1,3-thiazolidin-3-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(CN1CCSC1=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H19F3N4O2S/c13-12(14,15)9(18-3-1-16-2-4-18)7-17-10(20)8-19-5-6-22-11(19)21/h9,16H,1-8H2,(H,17,20) |
| InChIKey | FXNVJBDDADNIJD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|