C19H26F3N3O — CID 120812609
2-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide (PubChem CID 120812609) has the molecular formula C19H26F3N3O and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide.
| Compound Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 120812609 |
| Molecular Formula | C19H26F3N3O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 2-(5,6,7,8-tetrahydronaphthalen-2-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)acetamide |
| SMILES | O=C(Cc1ccc2c(c1)CCCC2)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C19H26F3N3O/c20-19(21,22)17(25-9-7-23-8-10-25)13-24-18(26)12-14-5-6-15-3-1-2-4-16(15)11-14/h5-6,11,17,23H,1-4,7-10,12-13H2,(H,24,26) |
| InChIKey | NVEQYDCWLUNVFO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |