C14H18F4N4O3S — CID 120812787
3-fluoro-4-sulfamoyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide (PubChem CID 120812787) has the molecular formula C14H18F4N4O3S and a molecular weight of 398.38 g/mol. Its IUPAC name is 3-fluoro-4-sulfamoyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide.
| Compound Name | 3-fluoro-4-sulfamoyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 120812787 |
| Molecular Formula | C14H18F4N4O3S |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 3-fluoro-4-sulfamoyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCC(N2CCNCC2)C(F)(F)F)cc1F |
| InChI | InChI=1S/C14H18F4N4O3S/c15-10-7-9(1-2-11(10)26(19,24)25)13(23)21-8-12(14(16,17)18)22-5-3-20-4-6-22/h1-2,7,12,20H,3-6,8H2,(H,21,23)(H2,19,24,25) |
| InChIKey | RJIUCXURSLBYSU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |