About 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide
3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (PubChem CID 120813237) has the molecular formula C15H26F3N3O2
and a molecular weight of 337.39 g/mol. Its IUPAC name is 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
Molecular Properties
| Compound Name | 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| PubChem CID | 120813237 |
| Molecular Formula | C15H26F3N3O2 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| SMILES | O=C(CCC1CCOCC1)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C15H26F3N3O2/c16-15(17,18)13(21-7-5-19-6-8-21)11-20-14(22)2-1-12-3-9-23-10-4-12/h12-13,19H,1-11H2,(H,20,22) |
| InChIKey | MIXAZOBQFWTZTN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
The IUPAC name of 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (CID 120813237) is 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
What is the SMILES notation for 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
The canonical SMILES for 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide is O=C(CCC1CCOCC1)NCC(N1CCNCC1)C(F)(F)F.
What is the InChIKey of 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
The InChIKey is MIXAZOBQFWTZTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26F3N3O2/c16-15(17,18)13(21-7-5-19-6-8-21)11-20-14(22)2-1-12-3-9-23-10-4-12/h12-13,19H,1-11H2,(H,20,22).
What are the key properties of 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide has a molecular weight of 337.39 g/mol, XLogP of 1.15, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(oxan-4-yl)-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide is sourced from PubChem (CID 120813237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).