About 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide
2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (PubChem CID 120813245) has the molecular formula C17H30F3N3O2
and a molecular weight of 365.44 g/mol. Its IUPAC name is 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
Molecular Properties
| Compound Name | 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| PubChem CID | 120813245 |
| Molecular Formula | C17H30F3N3O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.23 |
| IUPAC Name | 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide |
| SMILES | CC(OC1CCCCCC1)C(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C17H30F3N3O2/c1-13(25-14-6-4-2-3-5-7-14)16(24)22-12-15(17(18,19)20)23-10-8-21-9-11-23/h13-15,21H,2-12H2,1H3,(H,22,24) |
| InChIKey | WZQVGKZDSQFJBJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
The IUPAC name of 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide (CID 120813245) is 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide.
What is the SMILES notation for 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
The canonical SMILES for 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide is CC(OC1CCCCCC1)C(=O)NCC(N1CCNCC1)C(F)(F)F.
What is the InChIKey of 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
The InChIKey is WZQVGKZDSQFJBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30F3N3O2/c1-13(25-14-6-4-2-3-5-7-14)16(24)22-12-15(17(18,19)20)23-10-8-21-9-11-23/h13-15,21H,2-12H2,1H3,(H,22,24).
What are the key properties of 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide?
2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide has a molecular weight of 365.44 g/mol, XLogP of 2.07, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyloxy-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)propanamide is sourced from PubChem (CID 120813245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).