About 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide
4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide (PubChem CID 120813397) has the molecular formula C12H18F3N5OS
and a molecular weight of 337.37 g/mol. Its IUPAC name is 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide |
| PubChem CID | 120813397 |
| Molecular Formula | C12H18F3N5OS |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCC(N1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H18F3N5OS/c1-2-8-10(22-19-18-8)11(21)17-7-9(12(13,14)15)20-5-3-16-4-6-20/h9,16H,2-7H2,1H3,(H,17,21) |
| InChIKey | JHWHNVLQYDNTND-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
The IUPAC name of 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide (CID 120813397) is 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide.
What is the SMILES notation for 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
The canonical SMILES for 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide is CCc1nnsc1C(=O)NCC(N1CCNCC1)C(F)(F)F.
What is the InChIKey of 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
The InChIKey is JHWHNVLQYDNTND-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F3N5OS/c1-2-8-10(22-19-18-8)11(21)17-7-9(12(13,14)15)20-5-3-16-4-6-20/h9,16H,2-7H2,1H3,(H,17,21).
What are the key properties of 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide?
4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide has a molecular weight of 337.37 g/mol, XLogP of 0.67, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)thiadiazole-5-carboxamide is sourced from PubChem (CID 120813397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).