About 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide
1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide (PubChem CID 120813621) has the molecular formula C14H24F3N3O
and a molecular weight of 307.36 g/mol. Its IUPAC name is 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide |
| PubChem CID | 120813621 |
| Molecular Formula | C14H24F3N3O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide |
| SMILES | CCC1(C(=O)NCC(N2CCNCC2)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C14H24F3N3O/c1-2-13(4-3-5-13)12(21)19-10-11(14(15,16)17)20-8-6-18-7-9-20/h11,18H,2-10H2,1H3,(H,19,21) |
| InChIKey | RLHKMGHIABDFAD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide?
The IUPAC name of 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide (CID 120813621) is 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide.
What is the SMILES notation for 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide?
The canonical SMILES for 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide is CCC1(C(=O)NCC(N2CCNCC2)C(F)(F)F)CCC1.
What is the InChIKey of 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide?
The InChIKey is RLHKMGHIABDFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24F3N3O/c1-2-13(4-3-5-13)12(21)19-10-11(14(15,16)17)20-8-6-18-7-9-20/h11,18H,2-10H2,1H3,(H,19,21).
What are the key properties of 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide?
1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide has a molecular weight of 307.36 g/mol, XLogP of 1.52, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-N-(3,3,3-trifluoro-2-piperazin-1-ylpropyl)cyclobutane-1-carboxamide is sourced from PubChem (CID 120813621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).