C21H25N3O3 — CID 120816522
4-[4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)phenoxy]benzamide (PubChem CID 120816522) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-[4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)phenoxy]benzamide.
| Compound Name | 4-[4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 120816522 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 4-[4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)phenoxy]benzamide |
| SMILES | CC1(C)CN(C(=O)c2ccc(Oc3ccc(C(N)=O)cc3)cc2)CCC1N |
| InChI | InChI=1S/C21H25N3O3/c1-21(2)13-24(12-11-18(21)22)20(26)15-5-9-17(10-6-15)27-16-7-3-14(4-8-16)19(23)25/h3-10,18H,11-13,22H2,1-2H3,(H2,23,25) |
| InChIKey | RJLQLLBDNCPFNF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |