About 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride
4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride (PubChem CID 120818154) has the molecular formula C14H21ClFN3O3S
and a molecular weight of 365.86 g/mol. Its IUPAC name is 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride.
Molecular Properties
| Compound Name | 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride |
| PubChem CID | 120818154 |
| Molecular Formula | C14H21ClFN3O3S |
| Molecular Weight | 365.86 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride |
| SMILES | CC1(C)CN(C(=O)c2ccc(S(N)(=O)=O)c(F)c2)CCC1N.Cl |
| InChI | InChI=1S/C14H20FN3O3S.ClH/c1-14(2)8-18(6-5-12(14)16)13(19)9-3-4-11(10(15)7-9)22(17,20)21;/h3-4,7,12H,5-6,8,16H2,1-2H3,(H2,17,20,21);1H |
| InChIKey | OTPKEWQHOHHTMO-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 106.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.86 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride?
The IUPAC name of 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride (CID 120818154) is 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride.
What is the SMILES notation for 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride?
The canonical SMILES for 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride is CC1(C)CN(C(=O)c2ccc(S(N)(=O)=O)c(F)c2)CCC1N.Cl.
What is the InChIKey of 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride?
The InChIKey is OTPKEWQHOHHTMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FN3O3S.ClH/c1-14(2)8-18(6-5-12(14)16)13(19)9-3-4-11(10(15)7-9)22(17,20)21;/h3-4,7,12H,5-6,8,16H2,1-2H3,(H2,17,20,21);1H.
What are the key properties of 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride?
4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride has a molecular weight of 365.86 g/mol, XLogP of 1.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-2-fluorobenzenesulfonamide;hydrochloride is sourced from PubChem (CID 120818154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).