About 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride
1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride (PubChem CID 120819001) has the molecular formula C18H35ClN2O2
and a molecular weight of 346.94 g/mol. Its IUPAC name is 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride.
Molecular Properties
| Compound Name | 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride |
| PubChem CID | 120819001 |
| Molecular Formula | C18H35ClN2O2 |
| Molecular Weight | 346.94 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride |
| SMILES | CCC(OC1CCCC(C)C1)C(=O)N1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C18H34N2O2.ClH/c1-5-15(22-14-8-6-7-13(2)11-14)17(21)20-10-9-16(19)18(3,4)12-20;/h13-16H,5-12,19H2,1-4H3;1H |
| InChIKey | WUCCTSOYVHQWAO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.94 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride?
The IUPAC name of 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride (CID 120819001) is 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride.
What is the SMILES notation for 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride?
The canonical SMILES for 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride is CCC(OC1CCCC(C)C1)C(=O)N1CCC(N)C(C)(C)C1.Cl.
What is the InChIKey of 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride?
The InChIKey is WUCCTSOYVHQWAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34N2O2.ClH/c1-5-15(22-14-8-6-7-13(2)11-14)17(21)20-10-9-16(19)18(3,4)12-20;/h13-16H,5-12,19H2,1-4H3;1H.
What are the key properties of 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride?
1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride has a molecular weight of 346.94 g/mol, XLogP of 3.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-3,3-dimethylpiperidin-1-yl)-2-(3-methylcyclohexyl)oxybutan-1-one;hydrochloride is sourced from PubChem (CID 120819001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).