C21H31N3O2 — CID 120819107
3-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-1-(4-propan-2-ylphenyl)pyrrolidin-2-one (PubChem CID 120819107) has the molecular formula C21H31N3O2 and a molecular weight of 357.50 g/mol. Its IUPAC name is 3-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-1-(4-propan-2-ylphenyl)pyrrolidin-2-one.
| Compound Name | 3-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-1-(4-propan-2-ylphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 120819107 |
| Molecular Formula | C21H31N3O2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | 3-(4-amino-3,3-dimethylpiperidine-1-carbonyl)-1-(4-propan-2-ylphenyl)pyrrolidin-2-one |
| SMILES | CC(C)c1ccc(N2CCC(C(=O)N3CCC(N)C(C)(C)C3)C2=O)cc1 |
| InChI | InChI=1S/C21H31N3O2/c1-14(2)15-5-7-16(8-6-15)24-12-9-17(20(24)26)19(25)23-11-10-18(22)21(3,4)13-23/h5-8,14,17-18H,9-13,22H2,1-4H3 |
| InChIKey | HHGONKFWZBVGHH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|