C19H20N4OS2 — CID 1208225
N-[(3-cyano-5,5,6-trimethyl-4,7-dihydrothieno[2,3-c]pyridin-2-yl)carbamothioyl]benzamide (PubChem CID 1208225) has the molecular formula C19H20N4OS2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-[(3-cyano-5,5,6-trimethyl-4,7-dihydrothieno[2,3-c]pyridin-2-yl)carbamothioyl]benzamide.
| Compound Name | N-[(3-cyano-5,5,6-trimethyl-4,7-dihydrothieno[2,3-c]pyridin-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1208225 |
| Molecular Formula | C19H20N4OS2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | N-[(3-cyano-5,5,6-trimethyl-4,7-dihydrothieno[2,3-c]pyridin-2-yl)carbamothioyl]benzamide |
| SMILES | CN1Cc2sc(NC(=S)NC(=O)c3ccccc3)c(C#N)c2CC1(C)C |
| InChI | InChI=1S/C19H20N4OS2/c1-19(2)9-13-14(10-20)17(26-15(13)11-23(19)3)22-18(25)21-16(24)12-7-5-4-6-8-12/h4-8H,9,11H2,1-3H3,(H2,21,22,24,25) |
| InChIKey | UISUIXNIEAADCJ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|