C19H19NO5 — CID 120822841
2-ethyl-5-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoyl]furan-3-carboxylic acid (PubChem CID 120822841) has the molecular formula C19H19NO5 and a molecular weight of 341.36 g/mol. Its IUPAC name is 2-ethyl-5-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoyl]furan-3-carboxylic acid.
| Compound Name | 2-ethyl-5-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoyl]furan-3-carboxylic acid |
|---|---|
| PubChem CID | 120822841 |
| Molecular Formula | C19H19NO5 |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-ethyl-5-[[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]carbamoyl]furan-3-carboxylic acid |
| SMILES | CCc1oc(C(=O)N[C@@H](C)c2oc3ccccc3c2C)cc1C(=O)O |
| InChI | InChI=1S/C19H19NO5/c1-4-14-13(19(22)23)9-16(24-14)18(21)20-11(3)17-10(2)12-7-5-6-8-15(12)25-17/h5-9,11H,4H2,1-3H3,(H,20,21)(H,22,23)/t11-/m0/s1 |
| InChIKey | IFHMETRUVFCENN-NSHDSACASA-N |
| XLogP | 4.09 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |