C9H21N3O2S — CID 120824378
[methyl-[2-(methylamino)propylsulfamoyl]amino]methylcyclopropane (PubChem CID 120824378) has the molecular formula C9H21N3O2S and a molecular weight of 235.35 g/mol. Its IUPAC name is [methyl-[2-(methylamino)propylsulfamoyl]amino]methylcyclopropane.
| Compound Name | [methyl-[2-(methylamino)propylsulfamoyl]amino]methylcyclopropane |
|---|---|
| PubChem CID | 120824378 |
| Molecular Formula | C9H21N3O2S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | [methyl-[2-(methylamino)propylsulfamoyl]amino]methylcyclopropane |
| SMILES | CNC(C)CNS(=O)(=O)N(C)CC1CC1 |
| InChI | InChI=1S/C9H21N3O2S/c1-8(10-2)6-11-15(13,14)12(3)7-9-4-5-9/h8-11H,4-7H2,1-3H3 |
| InChIKey | VYPOCDCCXDGJBD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |