C20H27N3O3S — CID 120827257
3-[N-(benzenesulfonyl)-4-methylanilino]-N-[2-(methylamino)propyl]propanamide (PubChem CID 120827257) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 3-[N-(benzenesulfonyl)-4-methylanilino]-N-[2-(methylamino)propyl]propanamide.
| Compound Name | 3-[N-(benzenesulfonyl)-4-methylanilino]-N-[2-(methylamino)propyl]propanamide |
|---|---|
| PubChem CID | 120827257 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 3-[N-(benzenesulfonyl)-4-methylanilino]-N-[2-(methylamino)propyl]propanamide |
| SMILES | CNC(C)CNC(=O)CCN(c1ccc(C)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H27N3O3S/c1-16-9-11-18(12-10-16)23(14-13-20(24)22-15-17(2)21-3)27(25,26)19-7-5-4-6-8-19/h4-12,17,21H,13-15H2,1-3H3,(H,22,24) |
| InChIKey | DSMRSKVDDTYFBL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |