C17H26ClN3O2 — CID 120827980
1-(2-ethylphenyl)-N-[2-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride (PubChem CID 120827980) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-N-[2-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride.
| Compound Name | 1-(2-ethylphenyl)-N-[2-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120827980 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-(2-ethylphenyl)-N-[2-(methylamino)propyl]-5-oxopyrrolidine-3-carboxamide;hydrochloride |
| SMILES | CCc1ccccc1N1CC(C(=O)NCC(C)NC)CC1=O.Cl |
| InChI | InChI=1S/C17H25N3O2.ClH/c1-4-13-7-5-6-8-15(13)20-11-14(9-16(20)21)17(22)19-10-12(2)18-3;/h5-8,12,14,18H,4,9-11H2,1-3H3,(H,19,22);1H |
| InChIKey | KREFPKGQGWHTCX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |