C14H20ClIN2O2 — CID 120828900
4-(4-iodophenyl)-N-[2-(methylamino)propyl]-4-oxobutanamide;hydrochloride (PubChem CID 120828900) has the molecular formula C14H20ClIN2O2 and a molecular weight of 410.68 g/mol. Its IUPAC name is 4-(4-iodophenyl)-N-[2-(methylamino)propyl]-4-oxobutanamide;hydrochloride.
| Compound Name | 4-(4-iodophenyl)-N-[2-(methylamino)propyl]-4-oxobutanamide;hydrochloride |
|---|---|
| PubChem CID | 120828900 |
| Molecular Formula | C14H20ClIN2O2 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | 4-(4-iodophenyl)-N-[2-(methylamino)propyl]-4-oxobutanamide;hydrochloride |
| SMILES | CNC(C)CNC(=O)CCC(=O)c1ccc(I)cc1.Cl |
| InChI | InChI=1S/C14H19IN2O2.ClH/c1-10(16-2)9-17-14(19)8-7-13(18)11-3-5-12(15)6-4-11;/h3-6,10,16H,7-9H2,1-2H3,(H,17,19);1H |
| InChIKey | ABZOSGYRALTXPK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|