C13H15BrN2O2 — CID 120830399
5-bromo-N-[2-(methylamino)propyl]-1-benzofuran-2-carboxamide (PubChem CID 120830399) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is 5-bromo-N-[2-(methylamino)propyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-[2-(methylamino)propyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 120830399 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 5-bromo-N-[2-(methylamino)propyl]-1-benzofuran-2-carboxamide |
| SMILES | CNC(C)CNC(=O)c1cc2cc(Br)ccc2o1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-8(15-2)7-16-13(17)12-6-9-5-10(14)3-4-11(9)18-12/h3-6,8,15H,7H2,1-2H3,(H,16,17) |
| InChIKey | XPZSJLYZJILWSO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |