C14H19Cl2N3O — CID 120831709
N-[2-(methylamino)propyl]isoquinoline-1-carboxamide;dihydrochloride (PubChem CID 120831709) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is N-[2-(methylamino)propyl]isoquinoline-1-carboxamide;dihydrochloride.
| Compound Name | N-[2-(methylamino)propyl]isoquinoline-1-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120831709 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N-[2-(methylamino)propyl]isoquinoline-1-carboxamide;dihydrochloride |
| SMILES | CNC(C)CNC(=O)c1nccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C14H17N3O.2ClH/c1-10(15-2)9-17-14(18)13-12-6-4-3-5-11(12)7-8-16-13;;/h3-8,10,15H,9H2,1-2H3,(H,17,18);2*1H |
| InChIKey | DFKRQSZZEBRLKQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |