C17H23ClN4O — CID 120832789
1-(3-chlorophenyl)-N-[2-(methylamino)propyl]-5-propan-2-ylpyrazole-4-carboxamide (PubChem CID 120832789) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[2-(methylamino)propyl]-5-propan-2-ylpyrazole-4-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-N-[2-(methylamino)propyl]-5-propan-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 120832789 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[2-(methylamino)propyl]-5-propan-2-ylpyrazole-4-carboxamide |
| SMILES | CNC(C)CNC(=O)c1cnn(-c2cccc(Cl)c2)c1C(C)C |
| InChI | InChI=1S/C17H23ClN4O/c1-11(2)16-15(17(23)20-9-12(3)19-4)10-21-22(16)14-7-5-6-13(18)8-14/h5-8,10-12,19H,9H2,1-4H3,(H,20,23) |
| InChIKey | NRZFODMRIIZZPZ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |