C13H16BrF3N2 — CID 120834329
1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane (PubChem CID 120834329) has the molecular formula C13H16BrF3N2 and a molecular weight of 337.18 g/mol. Its IUPAC name is 1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane.
| Compound Name | 1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 120834329 |
| Molecular Formula | C13H16BrF3N2 |
| Molecular Weight | 337.18 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1-[[4-bromo-2-(trifluoromethyl)phenyl]methyl]-1,4-diazepane |
| SMILES | FC(F)(F)c1cc(Br)ccc1CN1CCCNCC1 |
| InChI | InChI=1S/C13H16BrF3N2/c14-11-3-2-10(12(8-11)13(15,16)17)9-19-6-1-4-18-5-7-19/h2-3,8,18H,1,4-7,9H2 |
| InChIKey | HHFIZSIDXLZKCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.18 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |