C14H22ClFN2 — CID 120834349
1-[2-(4-fluorophenyl)propyl]-1,4-diazepane;hydrochloride (PubChem CID 120834349) has the molecular formula C14H22ClFN2 and a molecular weight of 272.80 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)propyl]-1,4-diazepane;hydrochloride.
| Compound Name | 1-[2-(4-fluorophenyl)propyl]-1,4-diazepane;hydrochloride |
|---|---|
| PubChem CID | 120834349 |
| Molecular Formula | C14H22ClFN2 |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 1-[2-(4-fluorophenyl)propyl]-1,4-diazepane;hydrochloride |
| SMILES | CC(CN1CCCNCC1)c1ccc(F)cc1.Cl |
| InChI | InChI=1S/C14H21FN2.ClH/c1-12(13-3-5-14(15)6-4-13)11-17-9-2-7-16-8-10-17;/h3-6,12,16H,2,7-11H2,1H3;1H |
| InChIKey | XLYJRAOTXWTSEW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |