C13H20Cl2N2 — CID 120839112
(2S)-1-[(3-chloro-4-methylphenyl)methyl]-2-methylpiperazine;hydrochloride (PubChem CID 120839112) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is (2S)-1-[(3-chloro-4-methylphenyl)methyl]-2-methylpiperazine;hydrochloride.
| Compound Name | (2S)-1-[(3-chloro-4-methylphenyl)methyl]-2-methylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 120839112 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (2S)-1-[(3-chloro-4-methylphenyl)methyl]-2-methylpiperazine;hydrochloride |
| SMILES | Cc1ccc(CN2CCNC[C@@H]2C)cc1Cl.Cl |
| InChI | InChI=1S/C13H19ClN2.ClH/c1-10-3-4-12(7-13(10)14)9-16-6-5-15-8-11(16)2;/h3-4,7,11,15H,5-6,8-9H2,1-2H3;1H/t11-;/m0./s1 |
| InChIKey | OGIVHDMEIIOHNT-MERQFXBCSA-N |
| XLogP | 2.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |