About 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride
2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride (PubChem CID 120840429) has the molecular formula C15H23ClN4
and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride |
| PubChem CID | 120840429 |
| Molecular Formula | C15H23ClN4 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride |
| SMILES | Cc1ccccc1-n1nccc1CN(C)C(C)CN.Cl |
| InChI | InChI=1S/C15H22N4.ClH/c1-12-6-4-5-7-15(12)19-14(8-9-17-19)11-18(3)13(2)10-16;/h4-9,13H,10-11,16H2,1-3H3;1H |
| InChIKey | TWYWLBUHMNXXSX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride?
The IUPAC name of 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride (CID 120840429) is 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride.
What is the SMILES notation for 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride?
The canonical SMILES for 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride is Cc1ccccc1-n1nccc1CN(C)C(C)CN.Cl.
What is the InChIKey of 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride?
The InChIKey is TWYWLBUHMNXXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4.ClH/c1-12-6-4-5-7-15(12)19-14(8-9-17-19)11-18(3)13(2)10-16;/h4-9,13H,10-11,16H2,1-3H3;1H.
What are the key properties of 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride?
2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride has a molecular weight of 294.83 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-methyl-2-N-[[2-(2-methylphenyl)pyrazol-3-yl]methyl]propane-1,2-diamine;hydrochloride is sourced from PubChem (CID 120840429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).