About 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride
2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride (PubChem CID 120840451) has the molecular formula C11H16ClF2IN2
and a molecular weight of 376.62 g/mol. Its IUPAC name is 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride |
| PubChem CID | 120840451 |
| Molecular Formula | C11H16ClF2IN2 |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride |
| SMILES | CC(CN)N(C)Cc1c(F)ccc(I)c1F.Cl |
| InChI | InChI=1S/C11H15F2IN2.ClH/c1-7(5-15)16(2)6-8-9(12)3-4-10(14)11(8)13;/h3-4,7H,5-6,15H2,1-2H3;1H |
| InChIKey | SANHYLMQMDEZSE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
The IUPAC name of 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride (CID 120840451) is 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride.
What is the SMILES notation for 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
The canonical SMILES for 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride is CC(CN)N(C)Cc1c(F)ccc(I)c1F.Cl.
What is the InChIKey of 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
The InChIKey is SANHYLMQMDEZSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2IN2.ClH/c1-7(5-15)16(2)6-8-9(12)3-4-10(14)11(8)13;/h3-4,7H,5-6,15H2,1-2H3;1H.
What are the key properties of 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride?
2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride has a molecular weight of 376.62 g/mol, XLogP of 2.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-[(2,6-difluoro-3-iodophenyl)methyl]-2-N-methylpropane-1,2-diamine;hydrochloride is sourced from PubChem (CID 120840451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).