C13H15N3O3S — CID 120841276
3-(4-methylsulfonylphenyl)-5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole (PubChem CID 120841276) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 3-(4-methylsulfonylphenyl)-5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(4-methylsulfonylphenyl)-5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 120841276 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-(4-methylsulfonylphenyl)-5-[(3R)-pyrrolidin-3-yl]-1,2,4-oxadiazole |
| SMILES | CS(=O)(=O)c1ccc(-c2noc([C@@H]3CCNC3)n2)cc1 |
| InChI | InChI=1S/C13H15N3O3S/c1-20(17,18)11-4-2-9(3-5-11)12-15-13(19-16-12)10-6-7-14-8-10/h2-5,10,14H,6-8H2,1H3/t10-/m1/s1 |
| InChIKey | BVTNXTSNHSHCMK-SNVBAGLBSA-N |
| XLogP | 1.22 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |