About 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride
6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride (PubChem CID 120843286) has the molecular formula C15H22ClN3S
and a molecular weight of 311.88 g/mol. Its IUPAC name is 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride.
Molecular Properties
| Compound Name | 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride |
| PubChem CID | 120843286 |
| Molecular Formula | C15H22ClN3S |
| Molecular Weight | 311.88 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride |
| SMILES | Cc1nc2ccc(CN3CCNC(C)C3C)cc2s1.Cl |
| InChI | InChI=1S/C15H21N3S.ClH/c1-10-11(2)18(7-6-16-10)9-13-4-5-14-15(8-13)19-12(3)17-14;/h4-5,8,10-11,16H,6-7,9H2,1-3H3;1H |
| InChIKey | MEWYHIRLMFMMPL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride?
The IUPAC name of 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride (CID 120843286) is 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride.
What is the SMILES notation for 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride?
The canonical SMILES for 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride is Cc1nc2ccc(CN3CCNC(C)C3C)cc2s1.Cl.
What is the InChIKey of 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride?
The InChIKey is MEWYHIRLMFMMPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3S.ClH/c1-10-11(2)18(7-6-16-10)9-13-4-5-14-15(8-13)19-12(3)17-14;/h4-5,8,10-11,16H,6-7,9H2,1-3H3;1H.
What are the key properties of 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride?
6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride has a molecular weight of 311.88 g/mol, XLogP of 3.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,3-dimethylpiperazin-1-yl)methyl]-2-methyl-1,3-benzothiazole;hydrochloride is sourced from PubChem (CID 120843286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).