About N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride
N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride (PubChem CID 120843624) has the molecular formula C15H25ClN2O
and a molecular weight of 284.83 g/mol. Its IUPAC name is N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride |
| PubChem CID | 120843624 |
| Molecular Formula | C15H25ClN2O |
| Molecular Weight | 284.83 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride |
| SMILES | CNCCN(C)Cc1ccc(OCC2CC2)cc1.Cl |
| InChI | InChI=1S/C15H24N2O.ClH/c1-16-9-10-17(2)11-13-5-7-15(8-6-13)18-12-14-3-4-14;/h5-8,14,16H,3-4,9-12H2,1-2H3;1H |
| InChIKey | NCGCXIDVPIFISC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.83 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride?
The IUPAC name of N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride (CID 120843624) is N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride.
What is the SMILES notation for N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride?
The canonical SMILES for N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride is CNCCN(C)Cc1ccc(OCC2CC2)cc1.Cl.
What is the InChIKey of N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride?
The InChIKey is NCGCXIDVPIFISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O.ClH/c1-16-9-10-17(2)11-13-5-7-15(8-6-13)18-12-14-3-4-14;/h5-8,14,16H,3-4,9-12H2,1-2H3;1H.
What are the key properties of N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride?
N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride has a molecular weight of 284.83 g/mol, XLogP of 2.55, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[4-(cyclopropylmethoxy)phenyl]methyl]-N,N'-dimethylethane-1,2-diamine;hydrochloride is sourced from PubChem (CID 120843624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).