C15H27ClN4 — CID 120844094
2-[(2-propan-2-ylpyrazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride (PubChem CID 120844094) has the molecular formula C15H27ClN4 and a molecular weight of 298.86 g/mol. Its IUPAC name is 2-[(2-propan-2-ylpyrazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride.
| Compound Name | 2-[(2-propan-2-ylpyrazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120844094 |
| Molecular Formula | C15H27ClN4 |
| Molecular Weight | 298.86 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[(2-propan-2-ylpyrazol-3-yl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindol-4-amine;hydrochloride |
| SMILES | CC(C)n1nccc1CN1CC2CCCC(N)C2C1.Cl |
| InChI | InChI=1S/C15H26N4.ClH/c1-11(2)19-13(6-7-17-19)9-18-8-12-4-3-5-15(16)14(12)10-18;/h6-7,11-12,14-15H,3-5,8-10,16H2,1-2H3;1H |
| InChIKey | GJIFRHYXIRHPHY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.86 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |