C14H17Cl2FN2 — CID 120844234
2-[(2,3-dichloro-4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine (PubChem CID 120844234) has the molecular formula C14H17Cl2FN2 and a molecular weight of 303.21 g/mol. Its IUPAC name is 2-[(2,3-dichloro-4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine.
| Compound Name | 2-[(2,3-dichloro-4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
|---|---|
| PubChem CID | 120844234 |
| Molecular Formula | C14H17Cl2FN2 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-[(2,3-dichloro-4-fluorophenyl)methyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-amine |
| SMILES | NC1CCC2CN(Cc3ccc(F)c(Cl)c3Cl)CC12 |
| InChI | InChI=1S/C14H17Cl2FN2/c15-13-9(1-3-11(17)14(13)16)6-19-5-8-2-4-12(18)10(8)7-19/h1,3,8,10,12H,2,4-7,18H2 |
| InChIKey | NTHISFWLPUBUFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|